C16H20N8 — CID 133472424
N-(6-ethyl-2-methylpyrimidin-4-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine (PubChem CID 133472424) has the molecular formula C16H20N8 and a molecular weight of 324.39 g/mol. Its IUPAC name is N-(6-ethyl-2-methylpyrimidin-4-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine.
| Compound Name | N-(6-ethyl-2-methylpyrimidin-4-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133472424 |
| Molecular Formula | C16H20N8 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N-(6-ethyl-2-methylpyrimidin-4-yl)-N'-(1-phenyltetrazol-5-yl)ethane-1,2-diamine |
| SMILES | CCc1cc(NCCNc2nnnn2-c2ccccc2)nc(C)n1 |
| InChI | InChI=1S/C16H20N8/c1-3-13-11-15(20-12(2)19-13)17-9-10-18-16-21-22-23-24(16)14-7-5-4-6-8-14/h4-8,11H,3,9-10H2,1-2H3,(H,17,19,20)(H,18,21,23) |
| InChIKey | BRULKMWNKXCZDI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 93.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|