C13H13N7 — CID 60967739
N-[(2-methylpyrimidin-4-yl)methyl]-1-phenyltetrazol-5-amine (PubChem CID 60967739) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[(2-methylpyrimidin-4-yl)methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[(2-methylpyrimidin-4-yl)methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 60967739 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[(2-methylpyrimidin-4-yl)methyl]-1-phenyltetrazol-5-amine |
| SMILES | Cc1nccc(CNc2nnnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C13H13N7/c1-10-14-8-7-11(16-10)9-15-13-17-18-19-20(13)12-5-3-2-4-6-12/h2-8H,9H2,1H3,(H,15,17,19) |
| InChIKey | BHNWRCATBXDWLW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |