C15H15N5O2 — CID 133448175
2-methoxy-6-[[(1-phenyltetrazol-5-yl)amino]methyl]phenol (PubChem CID 133448175) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-methoxy-6-[[(1-phenyltetrazol-5-yl)amino]methyl]phenol.
| Compound Name | 2-methoxy-6-[[(1-phenyltetrazol-5-yl)amino]methyl]phenol |
|---|---|
| PubChem CID | 133448175 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-methoxy-6-[[(1-phenyltetrazol-5-yl)amino]methyl]phenol |
| SMILES | COc1cccc(CNc2nnnn2-c2ccccc2)c1O |
| InChI | InChI=1S/C15H15N5O2/c1-22-13-9-5-6-11(14(13)21)10-16-15-17-18-19-20(15)12-7-3-2-4-8-12/h2-9,21H,10H2,1H3,(H,16,17,19) |
| InChIKey | HXWUSOVKRPZAFN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|