C25H24N6O2 — CID 2464221
N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1-phenyltetrazol-5-amine (PubChem CID 2464221) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 2464221 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | N-[(2S)-2-(2,3-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]-1-phenyltetrazol-5-amine |
| SMILES | COc1cccc([C@@H](CNc2nnnn2-c2ccccc2)c2c[nH]c3ccccc23)c1OC |
| InChI | InChI=1S/C25H24N6O2/c1-32-23-14-8-12-19(24(23)33-2)21(20-15-26-22-13-7-6-11-18(20)22)16-27-25-28-29-30-31(25)17-9-4-3-5-10-17/h3-15,21,26H,16H2,1-2H3,(H,27,28,30)/t21-/m1/s1 |
| InChIKey | BZYZUHFAZAZPEW-OAQYLSRUSA-N |
| XLogP | 4.40 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |