C13H17N5 — CID 103736960
N-[(1-methylcyclobutyl)methyl]-1-phenyltetrazol-5-amine (PubChem CID 103736960) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-[(1-methylcyclobutyl)methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[(1-methylcyclobutyl)methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 103736960 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | N-[(1-methylcyclobutyl)methyl]-1-phenyltetrazol-5-amine |
| SMILES | CC1(CNc2nnnn2-c2ccccc2)CCC1 |
| InChI | InChI=1S/C13H17N5/c1-13(8-5-9-13)10-14-12-15-16-17-18(12)11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3,(H,14,15,17) |
| InChIKey | RSUBLIUEVMJNGO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |