C13H18N6 — CID 106026908
N-[(1-methylpyrrolidin-2-yl)methyl]-1-phenyltetrazol-5-amine (PubChem CID 106026908) has the molecular formula C13H18N6 and a molecular weight of 258.33 g/mol. Its IUPAC name is N-[(1-methylpyrrolidin-2-yl)methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[(1-methylpyrrolidin-2-yl)methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 106026908 |
| Molecular Formula | C13H18N6 |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | N-[(1-methylpyrrolidin-2-yl)methyl]-1-phenyltetrazol-5-amine |
| SMILES | CN1CCCC1CNc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C13H18N6/c1-18-9-5-8-12(18)10-14-13-15-16-17-19(13)11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3,(H,14,15,17) |
| InChIKey | RMZGFHWECUGQEG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |