C14H20N6 — CID 79110566
1-N-methyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine (PubChem CID 79110566) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 1-N-methyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine.
| Compound Name | 1-N-methyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79110566 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-N-methyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine |
| SMILES | CNC1CCC(Nc2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N6/c1-15-11-7-9-12(10-8-11)16-14-17-18-19-20(14)13-5-3-2-4-6-13/h2-6,11-12,15H,7-10H2,1H3,(H,16,17,19) |
| InChIKey | MXXPCVZJJCZCJJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |