C13H17N5O3 — CID 154817090
(2R,3S,4S)-2-(hydroxymethyl)-4-[(1-phenyltetrazol-5-yl)amino]oxan-3-ol (PubChem CID 154817090) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)-4-[(1-phenyltetrazol-5-yl)amino]oxan-3-ol.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)-4-[(1-phenyltetrazol-5-yl)amino]oxan-3-ol |
|---|---|
| PubChem CID | 154817090 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)-4-[(1-phenyltetrazol-5-yl)amino]oxan-3-ol |
| SMILES | OC[C@H]1OCC[C@H](Nc2nnnn2-c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C13H17N5O3/c19-8-11-12(20)10(6-7-21-11)14-13-15-16-17-18(13)9-4-2-1-3-5-9/h1-5,10-12,19-20H,6-8H2,(H,14,15,17)/t10-,11+,12-/m0/s1 |
| InChIKey | SPHDLTGVKAKBHS-TUAOUCFPSA-N |
| XLogP | -0.42 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |