C19H23N6+ — CID 2561113
1-benzyl-N-(1-phenyltetrazol-5-yl)piperidin-1-ium-4-amine (PubChem CID 2561113) has the molecular formula C19H23N6+ and a molecular weight of 335.44 g/mol. Its IUPAC name is 1-benzyl-N-(1-phenyltetrazol-5-yl)piperidin-1-ium-4-amine.
| Compound Name | 1-benzyl-N-(1-phenyltetrazol-5-yl)piperidin-1-ium-4-amine |
|---|---|
| PubChem CID | 2561113 |
| Molecular Formula | C19H23N6+ |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-benzyl-N-(1-phenyltetrazol-5-yl)piperidin-1-ium-4-amine |
| SMILES | c1ccc(C[NH+]2CCC(Nc3nnnn3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H22N6/c1-3-7-16(8-4-1)15-24-13-11-17(12-14-24)20-19-21-22-23-25(19)18-9-5-2-6-10-18/h1-10,17H,11-15H2,(H,20,21,23)/p+1 |
| InChIKey | RQJFMOCPBBZJFB-UHFFFAOYSA-O |
| XLogP | 1.32 |
| TPSA | 60.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |