C19H23N6O+ — CID 9023675
N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-1-phenyltetrazol-5-amine (PubChem CID 9023675) has the molecular formula C19H23N6O+ and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 9023675 |
| Molecular Formula | C19H23N6O+ |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | N-[[4-(morpholin-4-ium-4-ylmethyl)phenyl]methyl]-1-phenyltetrazol-5-amine |
| SMILES | c1ccc(-n2nnnc2NCc2ccc(C[NH+]3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C19H22N6O/c1-2-4-18(5-3-1)25-19(21-22-23-25)20-14-16-6-8-17(9-7-16)15-24-10-12-26-13-11-24/h1-9H,10-15H2,(H,20,21,23)/p+1 |
| InChIKey | AAPDXHYNEUAKQJ-UHFFFAOYSA-O |
| XLogP | 0.69 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |