C17H21N6OS+ — CID 9449726
N-[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]-1-phenyltetrazol-5-amine (PubChem CID 9449726) has the molecular formula C17H21N6OS+ and a molecular weight of 357.46 g/mol. Its IUPAC name is N-[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]-1-phenyltetrazol-5-amine.
| Compound Name | N-[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]-1-phenyltetrazol-5-amine |
|---|---|
| PubChem CID | 9449726 |
| Molecular Formula | C17H21N6OS+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(2S)-2-morpholin-4-ium-4-yl-2-thiophen-2-ylethyl]-1-phenyltetrazol-5-amine |
| SMILES | c1ccc(-n2nnnc2NC[C@@H](c2cccs2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C17H20N6OS/c1-2-5-14(6-3-1)23-17(19-20-21-23)18-13-15(16-7-4-12-25-16)22-8-10-24-11-9-22/h1-7,12,15H,8-11,13H2,(H,18,19,21)/p+1/t15-/m0/s1 |
| InChIKey | DPWKFYQVVUYGLR-HNNXBMFYSA-O |
| XLogP | 0.79 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |