C17H20N5OS+ — CID 7140876
4-[(S)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium (PubChem CID 7140876) has the molecular formula C17H20N5OS+ and a molecular weight of 342.45 g/mol. Its IUPAC name is 4-[(S)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium.
| Compound Name | 4-[(S)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium |
|---|---|
| PubChem CID | 7140876 |
| Molecular Formula | C17H20N5OS+ |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-[(S)-(1-benzyltetrazol-5-yl)-thiophen-2-ylmethyl]morpholin-4-ium |
| SMILES | c1ccc(Cn2nnnc2[C@@H](c2cccs2)[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C17H19N5OS/c1-2-5-14(6-3-1)13-22-17(18-19-20-22)16(15-7-4-12-24-15)21-8-10-23-11-9-21/h1-7,12,16H,8-11,13H2/p+1/t16-/m1/s1 |
| InChIKey | UBRGQNRYOZSQFP-MRXNPFEDSA-O |
| XLogP | 0.79 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |