C21H23F3N5+ — CID 7436538
1-[(R)-(1-benzyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-ium (PubChem CID 7436538) has the molecular formula C21H23F3N5+ and a molecular weight of 402.44 g/mol. Its IUPAC name is 1-[(R)-(1-benzyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-ium.
| Compound Name | 1-[(R)-(1-benzyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 7436538 |
| Molecular Formula | C21H23F3N5+ |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-[(R)-(1-benzyltetrazol-5-yl)-[4-(trifluoromethyl)phenyl]methyl]piperidin-1-ium |
| SMILES | FC(F)(F)c1ccc([C@H](c2nnnn2Cc2ccccc2)[NH+]2CCCCC2)cc1 |
| InChI | InChI=1S/C21H22F3N5/c22-21(23,24)18-11-9-17(10-12-18)19(28-13-5-2-6-14-28)20-25-26-27-29(20)15-16-7-3-1-4-8-16/h1,3-4,7-12,19H,2,5-6,13-15H2/p+1/t19-/m1/s1 |
| InChIKey | SMILMKSWIKPTFU-LJQANCHMSA-O |
| XLogP | 2.90 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |