C20H23ClN5S+ — CID 7390819
4-[(S)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium (PubChem CID 7390819) has the molecular formula C20H23ClN5S+ and a molecular weight of 400.96 g/mol. Its IUPAC name is 4-[(S)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium.
| Compound Name | 4-[(S)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 7390819 |
| Molecular Formula | C20H23ClN5S+ |
| Molecular Weight | 400.96 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 4-[(S)-(4-chlorophenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium |
| SMILES | Clc1ccc([C@@H](c2nnnn2CCc2ccccc2)[NH+]2CCSCC2)cc1 |
| InChI | InChI=1S/C20H22ClN5S/c21-18-8-6-17(7-9-18)19(25-12-14-27-15-13-25)20-22-23-24-26(20)11-10-16-4-2-1-3-5-16/h1-9,19H,10-15H2/p+1/t19-/m0/s1 |
| InChIKey | OMVOIQOJAQKYML-IBGZPJMESA-O |
| XLogP | 2.29 |
| TPSA | 48.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.96 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |