C15H21ClN5OS+ — CID 7140574
4-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium (PubChem CID 7140574) has the molecular formula C15H21ClN5OS+ and a molecular weight of 354.89 g/mol. Its IUPAC name is 4-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium.
| Compound Name | 4-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium |
|---|---|
| PubChem CID | 7140574 |
| Molecular Formula | C15H21ClN5OS+ |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 4-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]thiomorpholin-4-ium |
| SMILES | COCCn1nnnc1[C@@H](c1ccc(Cl)cc1)[NH+]1CCSCC1 |
| InChI | InChI=1S/C15H20ClN5OS/c1-22-9-6-21-15(17-18-19-21)14(20-7-10-23-11-8-20)12-2-4-13(16)5-3-12/h2-5,14H,6-11H2,1H3/p+1/t14-/m1/s1 |
| InChIKey | YINGIBDBRNUKBV-CQSZACIVSA-O |
| XLogP | 0.69 |
| TPSA | 57.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |