C17H25N6O2+ — CID 7391555
1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide (PubChem CID 7391555) has the molecular formula C17H25N6O2+ and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7391555 |
| Molecular Formula | C17H25N6O2+ |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | 1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-phenylmethyl]piperidin-1-ium-4-carboxamide |
| SMILES | COCCn1nnnc1[C@@H](c1ccccc1)[NH+]1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H24N6O2/c1-25-12-11-23-17(19-20-21-23)15(13-5-3-2-4-6-13)22-9-7-14(8-10-22)16(18)24/h2-6,14-15H,7-12H2,1H3,(H2,18,24)/p+1/t15-/m1/s1 |
| InChIKey | MOHNFHGRZNUPIL-OAHLLOKOSA-O |
| XLogP | -0.81 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |