C17H23FN6O2 — CID 7391700
1-[(R)-(2-fluorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 7391700) has the molecular formula C17H23FN6O2 and a molecular weight of 362.41 g/mol. Its IUPAC name is 1-[(R)-(2-fluorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(R)-(2-fluorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7391700 |
| Molecular Formula | C17H23FN6O2 |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-[(R)-(2-fluorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | COCCn1nnnc1[C@@H](c1ccccc1F)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H23FN6O2/c1-26-11-10-24-17(20-21-22-24)15(13-4-2-3-5-14(13)18)23-8-6-12(7-9-23)16(19)25/h2-5,12,15H,6-11H2,1H3,(H2,19,25)/t15-/m1/s1 |
| InChIKey | OFEUILGTSHYHTP-OAHLLOKOSA-N |
| XLogP | 0.75 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |