C19H21FN6O2 — CID 648515
1-[(2-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 648515) has the molecular formula C19H21FN6O2 and a molecular weight of 384.42 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 648515 |
| Molecular Formula | C19H21FN6O2 |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1-[(2-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(c2ccccc2F)c2nnnn2Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H21FN6O2/c20-16-6-2-1-5-15(16)17(25-9-7-13(8-10-25)18(21)27)19-22-23-24-26(19)12-14-4-3-11-28-14/h1-6,11,13,17H,7-10,12H2,(H2,21,27) |
| InChIKey | CUWFGFGOADPBBU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |