C23H23ClN6O — CID 1447390
1-[(S)-(2-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-phenylpiperazine (PubChem CID 1447390) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 1-[(S)-(2-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-phenylpiperazine.
| Compound Name | 1-[(S)-(2-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 1447390 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 1-[(S)-(2-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-phenylpiperazine |
| SMILES | Clc1ccccc1[C@@H](c1nnnn1Cc1ccco1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23ClN6O/c24-21-11-5-4-10-20(21)22(23-25-26-27-30(23)17-19-9-6-16-31-19)29-14-12-28(13-15-29)18-7-2-1-3-8-18/h1-11,16,22H,12-15,17H2/t22-/m0/s1 |
| InChIKey | GDWIYLDGNDYOMK-QFIPXVFZSA-N |
| XLogP | 3.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |