C18H26N6O2 — CID 7391572
1-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 7391572) has the molecular formula C18H26N6O2 and a molecular weight of 358.45 g/mol. Its IUPAC name is 1-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 7391572 |
| Molecular Formula | C18H26N6O2 |
| Molecular Weight | 358.45 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 1-[(S)-[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COCCn1nnnc1[C@H](c1ccc(C)cc1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C18H26N6O2/c1-13-3-5-14(6-4-13)16(18-20-21-22-24(18)11-12-26-2)23-9-7-15(8-10-23)17(19)25/h3-6,15-16H,7-12H2,1-2H3,(H2,19,25)/t16-/m0/s1 |
| InChIKey | AIBAPXVNOOLIFF-INIZCTEOSA-N |
| XLogP | 0.91 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |