C19H27ClN6O — CID 3210366
1-[(4-chlorophenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide (PubChem CID 3210366) has the molecular formula C19H27ClN6O and a molecular weight of 390.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3210366 |
| Molecular Formula | C19H27ClN6O |
| Molecular Weight | 390.92 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[(4-chlorophenyl)-[1-(3-methylbutyl)tetrazol-5-yl]methyl]piperidine-4-carboxamide |
| SMILES | CC(C)CCn1nnnc1C(c1ccc(Cl)cc1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H27ClN6O/c1-13(2)7-12-26-19(22-23-24-26)17(14-3-5-16(20)6-4-14)25-10-8-15(9-11-25)18(21)27/h3-6,13,15,17H,7-12H2,1-2H3,(H2,21,27) |
| InChIKey | NYOIDQJQJNIQEP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.92 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |