C23H30N6O2 — CID 3209284
1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 3209284) has the molecular formula C23H30N6O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3209284 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COCCn1nnnc1C(c1ccc(C)cc1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H30N6O2/c1-18-4-6-19(7-5-18)22(23-24-25-26-29(23)16-17-30-2)28-14-12-27(13-15-28)20-8-10-21(31-3)11-9-20/h4-11,22H,12-17H2,1-3H3 |
| InChIKey | MINICHCQCUZYLS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|