C27H29N7O3 — CID 3209968
1-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-nitrophenyl)piperazine (PubChem CID 3209968) has the molecular formula C27H29N7O3 and a molecular weight of 499.58 g/mol. Its IUPAC name is 1-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 3209968 |
| Molecular Formula | C27H29N7O3 |
| Molecular Weight | 499.58 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 1-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]-4-(4-nitrophenyl)piperazine |
| SMILES | COc1ccc(Cn2nnnc2C(c2ccc(C)cc2)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| InChI | InChI=1S/C27H29N7O3/c1-20-3-7-22(8-4-20)26(27-28-29-30-33(27)19-21-5-13-25(37-2)14-6-21)32-17-15-31(16-18-32)23-9-11-24(12-10-23)34(35)36/h3-14,26H,15-19H2,1-2H3 |
| InChIKey | XVPMGUDCJALDCW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|