C28H32N6O — CID 3209973
1-benzyl-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]piperazine (PubChem CID 3209973) has the molecular formula C28H32N6O and a molecular weight of 468.61 g/mol. Its IUPAC name is 1-benzyl-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]piperazine.
| Compound Name | 1-benzyl-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3209973 |
| Molecular Formula | C28H32N6O |
| Molecular Weight | 468.61 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1-benzyl-4-[[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]-(4-methylphenyl)methyl]piperazine |
| SMILES | COc1ccc(Cn2nnnc2C(c2ccc(C)cc2)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H32N6O/c1-22-8-12-25(13-9-22)27(33-18-16-32(17-19-33)20-23-6-4-3-5-7-23)28-29-30-31-34(28)21-24-10-14-26(35-2)15-11-24/h3-15,27H,16-21H2,1-2H3 |
| InChIKey | LHIAZFVIUYUFOG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |