C24H26N8O — CID 6557850
2-[4-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]piperazin-1-yl]pyrimidine (PubChem CID 6557850) has the molecular formula C24H26N8O and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-[4-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 6557850 |
| Molecular Formula | C24H26N8O |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 2-[4-[(S)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]piperazin-1-yl]pyrimidine |
| SMILES | COc1ccc([C@@H](c2nnnn2Cc2ccccc2)N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C24H26N8O/c1-33-21-10-8-20(9-11-21)22(23-27-28-29-32(23)18-19-6-3-2-4-7-19)30-14-16-31(17-15-30)24-25-12-5-13-26-24/h2-13,22H,14-18H2,1H3/t22-/m0/s1 |
| InChIKey | FIGRELMUBYRNQQ-QFIPXVFZSA-N |
| XLogP | 2.43 |
| TPSA | 85.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |