C27H30N6O2 — CID 1446260
1-[(R)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 1446260) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 1-[(R)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(R)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 1446260 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 1-[(R)-(1-benzyltetrazol-5-yl)-(4-methoxyphenyl)methyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc([C@H](c2nnnn2Cc2ccccc2)N2CCN(c3ccc(OC)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N6O2/c1-34-24-12-8-22(9-13-24)26(27-28-29-30-33(27)20-21-6-4-3-5-7-21)32-18-16-31(17-19-32)23-10-14-25(35-2)15-11-23/h3-15,26H,16-20H2,1-2H3/t26-/m1/s1 |
| InChIKey | STTOZLUSNXQKAA-AREMUKBSSA-N |
| XLogP | 3.65 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|