C22H28N6O2 — CID 3209327
1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]-4-phenylpiperazine (PubChem CID 3209327) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]-4-phenylpiperazine.
| Compound Name | 1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 3209327 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 1-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]-4-phenylpiperazine |
| SMILES | COCCn1nnnc1C(c1ccc(OC)cc1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H28N6O2/c1-29-17-16-28-22(23-24-25-28)21(18-8-10-20(30-2)11-9-18)27-14-12-26(13-15-27)19-6-4-3-5-7-19/h3-11,21H,12-17H2,1-2H3 |
| InChIKey | QNCFOGJGSDEFNJ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |