C27H30N6O — CID 3209721
1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine (PubChem CID 3209721) has the molecular formula C27H30N6O and a molecular weight of 454.58 g/mol. Its IUPAC name is 1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine.
| Compound Name | 1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 3209721 |
| Molecular Formula | C27H30N6O |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | 1-[(1-benzyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-phenylpiperazine |
| SMILES | CCOc1ccc(C(c2nnnn2Cc2ccccc2)N2CCN(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H30N6O/c1-2-34-25-15-13-23(14-16-25)26(27-28-29-30-33(27)21-22-9-5-3-6-10-22)32-19-17-31(18-20-32)24-11-7-4-8-12-24/h3-16,26H,2,17-21H2,1H3 |
| InChIKey | JPIKRJSBWOIODZ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |