C28H32N6O2 — CID 51625873
1-benzyl-4-[(R)-(1-benzyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]piperazine (PubChem CID 51625873) has the molecular formula C28H32N6O2 and a molecular weight of 484.60 g/mol. Its IUPAC name is 1-benzyl-4-[(R)-(1-benzyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-benzyl-4-[(R)-(1-benzyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 51625873 |
| Molecular Formula | C28H32N6O2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | 1-benzyl-4-[(R)-(1-benzyltetrazol-5-yl)-(3,4-dimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc([C@H](c2nnnn2Cc2ccccc2)N2CCN(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C28H32N6O2/c1-35-25-14-13-24(19-26(25)36-2)27(28-29-30-31-34(28)21-23-11-7-4-8-12-23)33-17-15-32(16-18-33)20-22-9-5-3-6-10-22/h3-14,19,27H,15-18,20-21H2,1-2H3/t27-/m1/s1 |
| InChIKey | HZXFRMYQZWHBBQ-HHHXNRCGSA-N |
| XLogP | 3.65 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |