C25H32N6O2 — CID 1449160
1-[(S)-(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine (PubChem CID 1449160) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 1-[(S)-(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(S)-(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1449160 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 1-[(S)-(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@@H](c2ccc(OC)c(OC)c2)c2nnnn2CCc2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N6O2/c1-4-13-29-15-17-30(18-16-29)24(21-10-11-22(32-2)23(19-21)33-3)25-26-27-28-31(25)14-12-20-8-6-5-7-9-20/h4-11,19,24H,1,12-18H2,2-3H3/t24-/m0/s1 |
| InChIKey | TZKYOVRCPPYFFK-DEOSSOPVSA-N |
| XLogP | 2.83 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|