C23H36N6O2 — CID 23969575
1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine (PubChem CID 23969575) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 23969575 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | 1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN(C(CC(C)C)c2nnnn2CCc2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C23H36N6O2/c1-6-10-27-12-14-28(15-13-27)20(16-18(2)3)23-24-25-26-29(23)11-9-19-7-8-21(30-4)22(17-19)31-5/h6-8,17-18,20H,1,9-16H2,2-5H3 |
| InChIKey | XWVKOCPFBODSJH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|