C21H32N6O2S — CID 1448880
1-[(1R)-3-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine (PubChem CID 1448880) has the molecular formula C21H32N6O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is 1-[(1R)-3-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(1R)-3-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1448880 |
| Molecular Formula | C21H32N6O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 1-[(1R)-3-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](CC(C)C)c2nnnn2CS(=O)(=O)c2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C21H32N6O2S/c1-5-10-25-11-13-26(14-12-25)20(15-17(2)3)21-22-23-24-27(21)16-30(28,29)19-8-6-18(4)7-9-19/h5-9,17,20H,1,10-16H2,2-4H3/t20-/m1/s1 |
| InChIKey | VHLKQBAYJGAVNV-HXUWFJFHSA-N |
| XLogP | 2.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|