C20H30N6O3S — CID 3210437
1-[1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]pentyl]piperidine-4-carboxamide (PubChem CID 3210437) has the molecular formula C20H30N6O3S and a molecular weight of 434.57 g/mol. Its IUPAC name is 1-[1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]pentyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]pentyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3210437 |
| Molecular Formula | C20H30N6O3S |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]pentyl]piperidine-4-carboxamide |
| SMILES | CCCCC(c1nnnn1CS(=O)(=O)c1ccc(C)cc1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C20H30N6O3S/c1-3-4-5-18(25-12-10-16(11-13-25)19(21)27)20-22-23-24-26(20)14-30(28,29)17-8-6-15(2)7-9-17/h6-9,16,18H,3-5,10-14H2,1-2H3,(H2,21,27) |
| InChIKey | QHPOCMSROQTZRM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |