C19H28N6O3S — CID 1448806
1-[(1S)-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]piperidine-4-carboxamide (PubChem CID 1448806) has the molecular formula C19H28N6O3S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-[(1S)-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[(1S)-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1448806 |
| Molecular Formula | C19H28N6O3S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[(1S)-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]butyl]piperidine-4-carboxamide |
| SMILES | CCC[C@@H](c1nnnn1CS(=O)(=O)c1ccc(C)cc1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C19H28N6O3S/c1-3-4-17(24-11-9-15(10-12-24)18(20)26)19-21-22-23-25(19)13-29(27,28)16-7-5-14(2)6-8-16/h5-8,15,17H,3-4,9-13H2,1-2H3,(H2,20,26)/t17-/m0/s1 |
| InChIKey | XCXCMPQQWBQWMS-KRWDZBQOSA-N |
| XLogP | 1.45 |
| TPSA | 124.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |