C17H25N5O2S2 — CID 1431626
4-[(1R)-2-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]propyl]thiomorpholine (PubChem CID 1431626) has the molecular formula C17H25N5O2S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 4-[(1R)-2-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]propyl]thiomorpholine.
| Compound Name | 4-[(1R)-2-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]propyl]thiomorpholine |
|---|---|
| PubChem CID | 1431626 |
| Molecular Formula | C17H25N5O2S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 4-[(1R)-2-methyl-1-[1-[(4-methylphenyl)sulfonylmethyl]tetrazol-5-yl]propyl]thiomorpholine |
| SMILES | Cc1ccc(S(=O)(=O)Cn2nnnc2[C@@H](C(C)C)N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H25N5O2S2/c1-13(2)16(21-8-10-25-11-9-21)17-18-19-20-22(17)12-26(23,24)15-6-4-14(3)5-7-15/h4-7,13,16H,8-12H2,1-3H3/t16-/m1/s1 |
| InChIKey | FMCHUTLRPACALU-MRXNPFEDSA-N |
| XLogP | 2.16 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |