C21H33ClN6 — CID 171668540
1-[[1-(3-methylbutyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride (PubChem CID 171668540) has the molecular formula C21H33ClN6 and a molecular weight of 404.99 g/mol. Its IUPAC name is 1-[[1-(3-methylbutyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride.
| Compound Name | 1-[[1-(3-methylbutyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171668540 |
| Molecular Formula | C21H33ClN6 |
| Molecular Weight | 404.99 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | 1-[[1-(3-methylbutyl)tetrazol-5-yl]-(4-methylphenyl)methyl]-4-prop-2-enylpiperazine;hydrochloride |
| SMILES | C=CCN1CCN(C(c2ccc(C)cc2)c2nnnn2CCC(C)C)CC1.Cl |
| InChI | InChI=1S/C21H32N6.ClH/c1-5-11-25-13-15-26(16-14-25)20(19-8-6-18(4)7-9-19)21-22-23-24-27(21)12-10-17(2)3;/h5-9,17,20H,1,10-16H2,2-4H3;1H |
| InChIKey | KJZJOWLURJFROV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.99 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|