C18H25ClN6O — CID 7391596
1-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine (PubChem CID 7391596) has the molecular formula C18H25ClN6O and a molecular weight of 376.89 g/mol. Its IUPAC name is 1-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 7391596 |
| Molecular Formula | C18H25ClN6O |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[(R)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](c2ccc(Cl)cc2)c2nnnn2CCOC)CC1 |
| InChI | InChI=1S/C18H25ClN6O/c1-3-8-23-9-11-24(12-10-23)17(15-4-6-16(19)7-5-15)18-20-21-22-25(18)13-14-26-2/h3-7,17H,1,8-14H2,2H3/t17-/m1/s1 |
| InChIKey | OBBQBUMOCWHQGG-QGZVFWFLSA-N |
| XLogP | 1.87 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|