C18H25ClN6O — CID 7140758
(8aS)-2-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 7140758) has the molecular formula C18H25ClN6O and a molecular weight of 376.89 g/mol. Its IUPAC name is (8aS)-2-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (8aS)-2-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 7140758 |
| Molecular Formula | C18H25ClN6O |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (8aS)-2-[(S)-(4-chlorophenyl)-[1-(2-methoxyethyl)tetrazol-5-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COCCn1nnnc1[C@H](c1ccc(Cl)cc1)N1CCN2CCC[C@H]2C1 |
| InChI | InChI=1S/C18H25ClN6O/c1-26-12-11-25-18(20-21-22-25)17(14-4-6-15(19)7-5-14)24-10-9-23-8-2-3-16(23)13-24/h4-7,16-17H,2-3,8-13H2,1H3/t16-,17-/m0/s1 |
| InChIKey | RPEMSTJEXQWAGN-IRXDYDNUSA-N |
| XLogP | 1.84 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |