C21H32N6O2 — CID 3209334
1-cyclopentyl-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine (PubChem CID 3209334) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-cyclopentyl-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-cyclopentyl-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 3209334 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-cyclopentyl-4-[[1-(2-methoxyethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine |
| SMILES | COCCn1nnnc1C(c1ccc(OC)cc1)N1CCN(C2CCCC2)CC1 |
| InChI | InChI=1S/C21H32N6O2/c1-28-16-15-27-21(22-23-24-27)20(17-7-9-19(29-2)10-8-17)26-13-11-25(12-14-26)18-5-3-4-6-18/h7-10,18,20H,3-6,11-16H2,1-2H3 |
| InChIKey | PRWSMLJWHZRGEC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |