C16H30N6O — CID 7391526
1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine (PubChem CID 7391526) has the molecular formula C16H30N6O and a molecular weight of 322.46 g/mol. Its IUPAC name is 1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 7391526 |
| Molecular Formula | C16H30N6O |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | 1-[(1R)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](CC(C)C)c2nnnn2CCOC)CC1 |
| InChI | InChI=1S/C16H30N6O/c1-5-6-20-7-9-21(10-8-20)15(13-14(2)3)16-17-18-19-22(16)11-12-23-4/h5,14-15H,1,6-13H2,2-4H3/t15-/m1/s1 |
| InChIKey | BJCDWBDKUIUKJA-OAHLLOKOSA-N |
| XLogP | 1.21 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|