C20H32N6O2 — CID 7098187
1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-(3-methoxyphenyl)piperazine (PubChem CID 7098187) has the molecular formula C20H32N6O2 and a molecular weight of 388.52 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-(3-methoxyphenyl)piperazine.
| Compound Name | 1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-(3-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 7098187 |
| Molecular Formula | C20H32N6O2 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]-3-methylbutyl]-4-(3-methoxyphenyl)piperazine |
| SMILES | COCCn1nnnc1[C@H](CC(C)C)N1CCN(c2cccc(OC)c2)CC1 |
| InChI | InChI=1S/C20H32N6O2/c1-16(2)14-19(20-21-22-23-26(20)12-13-27-3)25-10-8-24(9-11-25)17-6-5-7-18(15-17)28-4/h5-7,15-16,19H,8-14H2,1-4H3/t19-/m0/s1 |
| InChIKey | HSNUPLPFRPCQSA-IBGZPJMESA-N |
| XLogP | 2.24 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |