C27H38N6O3 — CID 3210590
1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 3210590) has the molecular formula C27H38N6O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3210590 |
| Molecular Formula | C27H38N6O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | 1-[1-[1-[2-(3,4-dimethoxyphenyl)ethyl]tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(C(CC(C)C)c3nnnn3CCc3ccc(OC)c(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C27H38N6O3/c1-20(2)18-24(32-16-14-31(15-17-32)22-7-9-23(34-3)10-8-22)27-28-29-30-33(27)13-12-21-6-11-25(35-4)26(19-21)36-5/h6-11,19-20,24H,12-18H2,1-5H3 |
| InChIKey | YWGFQXIXBSMBAH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 77.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|