C25H32N6O3 — CID 1447514
1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 1447514) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 1447514 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | 1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN([C@@H](CC(C)C)c3nnnn3Cc3ccc4c(c3)OCO4)CC2)cc1 |
| InChI | InChI=1S/C25H32N6O3/c1-18(2)14-22(30-12-10-29(11-13-30)20-5-7-21(32-3)8-6-20)25-26-27-28-31(25)16-19-4-9-23-24(15-19)34-17-33-23/h4-9,15,18,22H,10-14,16-17H2,1-3H3/t22-/m0/s1 |
| InChIKey | CGXAJRSVJHAPMG-QFIPXVFZSA-N |
| XLogP | 3.37 |
| TPSA | 77.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|