C24H29N7O4 — CID 3210169
1-[1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-nitrophenyl)piperazine (PubChem CID 3210169) has the molecular formula C24H29N7O4 and a molecular weight of 479.54 g/mol. Its IUPAC name is 1-[1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-nitrophenyl)piperazine.
| Compound Name | 1-[1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-nitrophenyl)piperazine |
|---|---|
| PubChem CID | 3210169 |
| Molecular Formula | C24H29N7O4 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 1-[1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]-3-methylbutyl]-4-(4-nitrophenyl)piperazine |
| SMILES | CC(C)CC(c1nnnn1Cc1ccc2c(c1)OCO2)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C24H29N7O4/c1-17(2)13-21(29-11-9-28(10-12-29)19-4-6-20(7-5-19)31(32)33)24-25-26-27-30(24)15-18-3-8-22-23(14-18)35-16-34-22/h3-8,14,17,21H,9-13,15-16H2,1-2H3 |
| InChIKey | UOJCJYRCQUWIPP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|