C19H23N7O2S — CID 51685172
1-(4-nitrophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine (PubChem CID 51685172) has the molecular formula C19H23N7O2S and a molecular weight of 413.51 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine.
| Compound Name | 1-(4-nitrophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine |
|---|---|
| PubChem CID | 51685172 |
| Molecular Formula | C19H23N7O2S |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1-(4-nitrophenyl)-4-[(1S)-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazine |
| SMILES | CC[C@@H](c1nnnn1Cc1cccs1)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C19H23N7O2S/c1-2-18(19-20-21-22-25(19)14-17-4-3-13-29-17)24-11-9-23(10-12-24)15-5-7-16(8-6-15)26(27)28/h3-8,13,18H,2,9-12,14H2,1H3/t18-/m0/s1 |
| InChIKey | MVGPZGRUWWCVPN-SFHVURJKSA-N |
| XLogP | 2.96 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|