C20H24N8S2 — CID 127042420
2-[4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazin-1-yl]-1,3-benzothiazol-4-amine (PubChem CID 127042420) has the molecular formula C20H24N8S2 and a molecular weight of 440.60 g/mol. Its IUPAC name is 2-[4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazin-1-yl]-1,3-benzothiazol-4-amine.
| Compound Name | 2-[4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazin-1-yl]-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 127042420 |
| Molecular Formula | C20H24N8S2 |
| Molecular Weight | 440.60 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-[4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]propyl]piperazin-1-yl]-1,3-benzothiazol-4-amine |
| SMILES | CCC(c1nnnn1Cc1cccs1)N1CCN(c2nc3c(N)cccc3s2)CC1 |
| InChI | InChI=1S/C20H24N8S2/c1-2-16(19-23-24-25-28(19)13-14-5-4-12-29-14)26-8-10-27(11-9-26)20-22-18-15(21)6-3-7-17(18)30-20/h3-7,12,16H,2,8-11,13,21H2,1H3 |
| InChIKey | MYRISMVFJAYNRM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|