C21H28N6S — CID 1447737
1-[(1S)-3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]-4-phenylpiperazine (PubChem CID 1447737) has the molecular formula C21H28N6S and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-[(1S)-3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]-4-phenylpiperazine.
| Compound Name | 1-[(1S)-3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 1447737 |
| Molecular Formula | C21H28N6S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-[(1S)-3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]-4-phenylpiperazine |
| SMILES | CC(C)C[C@@H](c1nnnn1Cc1cccs1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H28N6S/c1-17(2)15-20(21-22-23-24-27(21)16-19-9-6-14-28-19)26-12-10-25(11-13-26)18-7-4-3-5-8-18/h3-9,14,17,20H,10-13,15-16H2,1-2H3/t20-/m0/s1 |
| InChIKey | QLQBGZXIFQTVTI-FQEVSTJZSA-N |
| XLogP | 3.69 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |