C17H26N6OS — CID 3210263
1-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperidine-4-carboxamide (PubChem CID 3210263) has the molecular formula C17H26N6OS and a molecular weight of 362.50 g/mol. Its IUPAC name is 1-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperidine-4-carboxamide.
| Compound Name | 1-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3210263 |
| Molecular Formula | C17H26N6OS |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperidine-4-carboxamide |
| SMILES | CC(C)CC(c1nnnn1Cc1cccs1)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C17H26N6OS/c1-12(2)10-15(22-7-5-13(6-8-22)16(18)24)17-19-20-21-23(17)11-14-4-3-9-25-14/h3-4,9,12-13,15H,5-8,10-11H2,1-2H3,(H2,18,24) |
| InChIKey | KUZWHQXZNIPFQP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |