C21H34N6S — CID 3210251
1-cyclohexyl-4-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperazine (PubChem CID 3210251) has the molecular formula C21H34N6S and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-cyclohexyl-4-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 3210251 |
| Molecular Formula | C21H34N6S |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-cyclohexyl-4-[3-methyl-1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
| SMILES | CC(C)CC(c1nnnn1Cc1cccs1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H34N6S/c1-17(2)15-20(21-22-23-24-27(21)16-19-9-6-14-28-19)26-12-10-25(11-13-26)18-7-4-3-5-8-18/h6,9,14,17-18,20H,3-5,7-8,10-13,15-16H2,1-2H3 |
| InChIKey | OYNQIALRDYCSBI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |