C21H34N6S — CID 5009676
1-cyclohexyl-4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine (PubChem CID 5009676) has the molecular formula C21H34N6S and a molecular weight of 402.61 g/mol. Its IUPAC name is 1-cyclohexyl-4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine |
|---|---|
| PubChem CID | 5009676 |
| Molecular Formula | C21H34N6S |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 1-cyclohexyl-4-[1-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]pentyl]piperazine |
| SMILES | CCCCC(c1nnnn1Cc1cccs1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H34N6S/c1-2-3-11-20(21-22-23-24-27(21)17-19-10-7-16-28-19)26-14-12-25(13-15-26)18-8-5-4-6-9-18/h7,10,16,18,20H,2-6,8-9,11-15,17H2,1H3 |
| InChIKey | MGPYLISHYSGRLI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |